About 3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine
3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65094704) has the molecular formula C6H11N3OS
and a molecular weight of 173.24 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | 3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine |
| PubChem CID | 65094704 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine |
| SMILES | COCCCc1nsc(N)n1 |
| InChI | InChI=1S/C6H11N3OS/c1-10-4-2-3-5-8-6(7)11-9-5/h2-4H2,1H3,(H2,7,8,9) |
| InChIKey | MAGOVRHFPGZVHW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine (CID 65094704) is 3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine is COCCCc1nsc(N)n1.
What is the InChIKey of 3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine?
The InChIKey is MAGOVRHFPGZVHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3OS/c1-10-4-2-3-5-8-6(7)11-9-5/h2-4H2,1H3,(H2,7,8,9).
What are the key properties of 3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine?
3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine has a molecular weight of 173.24 g/mol, XLogP of 0.70, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 65094704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).