About 3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine
3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine (PubChem CID 65094743) has the molecular formula C10H17N3O3
and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine.
Molecular Properties
| Compound Name | 3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine |
| PubChem CID | 65094743 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine |
| SMILES | COCCCc1noc(C2(N)CCOC2)n1 |
| InChI | InChI=1S/C10H17N3O3/c1-14-5-2-3-8-12-9(16-13-8)10(11)4-6-15-7-10/h2-7,11H2,1H3 |
| InChIKey | QGOKHVZNLVTJIT-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine?
The IUPAC name of 3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine (CID 65094743) is 3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine.
What is the SMILES notation for 3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine?
The canonical SMILES for 3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine is COCCCc1noc(C2(N)CCOC2)n1.
What is the InChIKey of 3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine?
The InChIKey is QGOKHVZNLVTJIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3/c1-14-5-2-3-8-12-9(16-13-8)10(11)4-6-15-7-10/h2-7,11H2,1H3.
What are the key properties of 3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine?
3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine has a molecular weight of 227.26 g/mol, XLogP of 0.22, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine is sourced from PubChem (CID 65094743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).