About 8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione
8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 650949) has the molecular formula C16H19N5O2
and a molecular weight of 313.36 g/mol. Its IUPAC name is 8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione |
| PubChem CID | 650949 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | CN(Cc1ccccc1)Cc1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H19N5O2/c1-19(9-11-7-5-4-6-8-11)10-12-17-13-14(18-12)20(2)16(23)21(3)15(13)22/h4-8H,9-10H2,1-3H3,(H,17,18) |
| InChIKey | LLVGFPWNUPYYTQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione?
The IUPAC name of 8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione (CID 650949) is 8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione.
What is the SMILES notation for 8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione?
The canonical SMILES for 8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione is CN(Cc1ccccc1)Cc1nc2c([nH]1)c(=O)n(C)c(=O)n2C.
What is the InChIKey of 8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione?
The InChIKey is LLVGFPWNUPYYTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5O2/c1-19(9-11-7-5-4-6-8-11)10-12-17-13-14(18-12)20(2)16(23)21(3)15(13)22/h4-8H,9-10H2,1-3H3,(H,17,18).
What are the key properties of 8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione?
8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione has a molecular weight of 313.36 g/mol, XLogP of 0.59, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[[benzyl(methyl)amino]methyl]-1,3-dimethyl-7H-purine-2,6-dione is sourced from PubChem (CID 650949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).