C15H25NO4S — CID 65095267
2-[3-ethoxy-2-(3-ethylsulfonylpropoxy)phenyl]ethanamine (PubChem CID 65095267) has the molecular formula C15H25NO4S and a molecular weight of 315.44 g/mol. Its IUPAC name is 2-[3-ethoxy-2-(3-ethylsulfonylpropoxy)phenyl]ethanamine.
| Compound Name | 2-[3-ethoxy-2-(3-ethylsulfonylpropoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 65095267 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-[3-ethoxy-2-(3-ethylsulfonylpropoxy)phenyl]ethanamine |
| SMILES | CCOc1cccc(CCN)c1OCCCS(=O)(=O)CC |
| InChI | InChI=1S/C15H25NO4S/c1-3-19-14-8-5-7-13(9-10-16)15(14)20-11-6-12-21(17,18)4-2/h5,7-8H,3-4,6,9-12,16H2,1-2H3 |
| InChIKey | ZDPRSECQPQBTLT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|