C16H27N3O5 — CID 6509529
(E)-but-2-enedioic acid;N,N-diethyl-3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carboxamide (PubChem CID 6509529) has the molecular formula C16H27N3O5 and a molecular weight of 341.41 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N,N-diethyl-3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carboxamide.
| Compound Name | (E)-but-2-enedioic acid;N,N-diethyl-3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carboxamide |
|---|---|
| PubChem CID | 6509529 |
| Molecular Formula | C16H27N3O5 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (E)-but-2-enedioic acid;N,N-diethyl-3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carboxamide |
| SMILES | CCN(CC)C(=O)N1C2CCC1CN(C)C2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C12H23N3O.C4H4O4/c1-4-14(5-2)12(16)15-10-6-7-11(15)9-13(3)8-10;5-3(6)1-2-4(7)8/h10-11H,4-9H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | BEPHFAAMLACRIJ-WLHGVMLRSA-N |
| XLogP | 0.94 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|