About 6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol
6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol (PubChem CID 65095387) has the molecular formula C8H15F3O3S
and a molecular weight of 248.27 g/mol. Its IUPAC name is 6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol.
Molecular Properties
| Compound Name | 6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol |
| PubChem CID | 65095387 |
| Molecular Formula | C8H15F3O3S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol |
| SMILES | CCS(=O)(=O)CCCC(O)CC(F)(F)F |
| InChI | InChI=1S/C8H15F3O3S/c1-2-15(13,14)5-3-4-7(12)6-8(9,10)11/h7,12H,2-6H2,1H3 |
| InChIKey | QQJNBTWSCLCLKX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol?
The IUPAC name of 6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol (CID 65095387) is 6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol.
What is the SMILES notation for 6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol?
The canonical SMILES for 6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol is CCS(=O)(=O)CCCC(O)CC(F)(F)F.
What is the InChIKey of 6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol?
The InChIKey is QQJNBTWSCLCLKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3O3S/c1-2-15(13,14)5-3-4-7(12)6-8(9,10)11/h7,12H,2-6H2,1H3.
What are the key properties of 6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol?
6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol has a molecular weight of 248.27 g/mol, XLogP of 1.51, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethylsulfonyl-1,1,1-trifluorohexan-3-ol is sourced from PubChem (CID 65095387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).