About 5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol
5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol (PubChem CID 65095940) has the molecular formula C7H13F3O3S
and a molecular weight of 234.24 g/mol. Its IUPAC name is 5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol.
Molecular Properties
| Compound Name | 5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol |
| PubChem CID | 65095940 |
| Molecular Formula | C7H13F3O3S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol |
| SMILES | CCS(=O)(=O)CCCC(O)C(F)(F)F |
| InChI | InChI=1S/C7H13F3O3S/c1-2-14(12,13)5-3-4-6(11)7(8,9)10/h6,11H,2-5H2,1H3 |
| InChIKey | OXEZRDPHHLYGFM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol?
The IUPAC name of 5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol (CID 65095940) is 5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol.
What is the SMILES notation for 5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol?
The canonical SMILES for 5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol is CCS(=O)(=O)CCCC(O)C(F)(F)F.
What is the InChIKey of 5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol?
The InChIKey is OXEZRDPHHLYGFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3O3S/c1-2-14(12,13)5-3-4-6(11)7(8,9)10/h6,11H,2-5H2,1H3.
What are the key properties of 5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol?
5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol has a molecular weight of 234.24 g/mol, XLogP of 1.12, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfonyl-1,1,1-trifluoropentan-2-ol is sourced from PubChem (CID 65095940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).