About 3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione
3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione (PubChem CID 65096322) has the molecular formula C12H22N2O4S
and a molecular weight of 290.38 g/mol. Its IUPAC name is 3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione.
Molecular Properties
| Compound Name | 3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione |
| PubChem CID | 65096322 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione |
| SMILES | CCC1NC(=O)CCN(CCCS(=O)(=O)CC)C1=O |
| InChI | InChI=1S/C12H22N2O4S/c1-3-10-12(16)14(8-6-11(15)13-10)7-5-9-19(17,18)4-2/h10H,3-9H2,1-2H3,(H,13,15) |
| InChIKey | LVMDUINDAJCQJG-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione?
The IUPAC name of 3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione (CID 65096322) is 3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione.
What is the SMILES notation for 3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione?
The canonical SMILES for 3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione is CCC1NC(=O)CCN(CCCS(=O)(=O)CC)C1=O.
What is the InChIKey of 3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione?
The InChIKey is LVMDUINDAJCQJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O4S/c1-3-10-12(16)14(8-6-11(15)13-10)7-5-9-19(17,18)4-2/h10H,3-9H2,1-2H3,(H,13,15).
What are the key properties of 3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione?
3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione has a molecular weight of 290.38 g/mol, XLogP of -0.06, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-(3-ethylsulfonylpropyl)-1,4-diazepane-2,5-dione is sourced from PubChem (CID 65096322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).