About 2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine
2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine (PubChem CID 65097119) has the molecular formula C14H29NO4S2
and a molecular weight of 339.52 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine.
Molecular Properties
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine |
| PubChem CID | 65097119 |
| Molecular Formula | C14H29NO4S2 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine |
| SMILES | CCS(=O)(=O)CCCC(CNC(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H29NO4S2/c1-4-20(16,17)8-5-6-13(10-15-12(2)3)14-7-9-21(18,19)11-14/h12-15H,4-11H2,1-3H3 |
| InChIKey | SZYDEIAJNAKETN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine (CID 65097119) is 2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine is CCS(=O)(=O)CCCC(CNC(C)C)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine?
The InChIKey is SZYDEIAJNAKETN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO4S2/c1-4-20(16,17)8-5-6-13(10-15-12(2)3)14-7-9-21(18,19)11-14/h12-15H,4-11H2,1-3H3.
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine?
2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine has a molecular weight of 339.52 g/mol, XLogP of 1.25, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine is sourced from PubChem (CID 65097119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).