C17H29NO2S — CID 65097173
2-benzyl-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine (PubChem CID 65097173) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is 2-benzyl-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine.
| Compound Name | 2-benzyl-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine |
|---|---|
| PubChem CID | 65097173 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-benzyl-5-ethylsulfonyl-N-propan-2-ylpentan-1-amine |
| SMILES | CCS(=O)(=O)CCCC(CNC(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C17H29NO2S/c1-4-21(19,20)12-8-11-17(14-18-15(2)3)13-16-9-6-5-7-10-16/h5-7,9-10,15,17-18H,4,8,11-14H2,1-3H3 |
| InChIKey | LLYLJQWZBQNFSB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |