About 5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine
5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine (PubChem CID 65097377) has the molecular formula C15H32N2O2S
and a molecular weight of 304.50 g/mol. Its IUPAC name is 5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine |
| PubChem CID | 65097377 |
| Molecular Formula | C15H32N2O2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine |
| SMILES | CCC(C)C1CN(CCCS(=O)(=O)CC)C(C)(C)CN1 |
| InChI | InChI=1S/C15H32N2O2S/c1-6-13(3)14-11-17(15(4,5)12-16-14)9-8-10-20(18,19)7-2/h13-14,16H,6-12H2,1-5H3 |
| InChIKey | IPLXQBOITOJJRM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine?
The IUPAC name of 5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine (CID 65097377) is 5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine.
What is the SMILES notation for 5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine?
The canonical SMILES for 5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine is CCC(C)C1CN(CCCS(=O)(=O)CC)C(C)(C)CN1.
What is the InChIKey of 5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine?
The InChIKey is IPLXQBOITOJJRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O2S/c1-6-13(3)14-11-17(15(4,5)12-16-14)9-8-10-20(18,19)7-2/h13-14,16H,6-12H2,1-5H3.
What are the key properties of 5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine?
5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine has a molecular weight of 304.50 g/mol, XLogP of 1.91, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-1-(3-ethylsulfonylpropyl)-2,2-dimethylpiperazine is sourced from PubChem (CID 65097377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).