About N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide
N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide (PubChem CID 65098713) has the molecular formula C10H11IN4O2S
and a molecular weight of 378.20 g/mol. Its IUPAC name is N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide |
| PubChem CID | 65098713 |
| Molecular Formula | C10H11IN4O2S |
| Molecular Weight | 378.20 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)Nc2ccc(I)cn2)cn1C |
| InChI | InChI=1S/C10H11IN4O2S/c1-7-13-10(6-15(7)2)18(16,17)14-9-4-3-8(11)5-12-9/h3-6H,1-2H3,(H,12,14) |
| InChIKey | CYERAAXFVGTHGI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide?
The IUPAC name of N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide (CID 65098713) is N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide.
What is the SMILES notation for N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide?
The canonical SMILES for N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide is Cc1nc(S(=O)(=O)Nc2ccc(I)cn2)cn1C.
What is the InChIKey of N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide?
The InChIKey is CYERAAXFVGTHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11IN4O2S/c1-7-13-10(6-15(7)2)18(16,17)14-9-4-3-8(11)5-12-9/h3-6H,1-2H3,(H,12,14).
What are the key properties of N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide?
N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide has a molecular weight of 378.20 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-iodo-2-pyridinyl)-1,2-dimethylimidazole-4-sulfonamide is sourced from PubChem (CID 65098713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).