About (2E)-2-inden-1-ylidene-N,N-dimethylethanamine
(2E)-2-inden-1-ylidene-N,N-dimethylethanamine (PubChem CID 6509875) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is (2E)-2-inden-1-ylidene-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | (2E)-2-inden-1-ylidene-N,N-dimethylethanamine |
| PubChem CID | 6509875 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (2E)-2-inden-1-ylidene-N,N-dimethylethanamine |
| SMILES | CN(C)C/C=C1\C=Cc2ccccc21 |
| InChI | InChI=1S/C13H15N/c1-14(2)10-9-12-8-7-11-5-3-4-6-13(11)12/h3-9H,10H2,1-2H3/b12-9+ |
| InChIKey | FOUFMYKHSMVECQ-FMIVXFBMSA-N |
| XLogP | 2.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2E)-2-inden-1-ylidene-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-inden-1-ylidene-N,N-dimethylethanamine?
The IUPAC name of (2E)-2-inden-1-ylidene-N,N-dimethylethanamine (CID 6509875) is (2E)-2-inden-1-ylidene-N,N-dimethylethanamine.
What is the SMILES notation for (2E)-2-inden-1-ylidene-N,N-dimethylethanamine?
The canonical SMILES for (2E)-2-inden-1-ylidene-N,N-dimethylethanamine is CN(C)C/C=C1\C=Cc2ccccc21.
What is the InChIKey of (2E)-2-inden-1-ylidene-N,N-dimethylethanamine?
The InChIKey is FOUFMYKHSMVECQ-FMIVXFBMSA-N. The full InChI is InChI=1S/C13H15N/c1-14(2)10-9-12-8-7-11-5-3-4-6-13(11)12/h3-9H,10H2,1-2H3/b12-9+.
What are the key properties of (2E)-2-inden-1-ylidene-N,N-dimethylethanamine?
(2E)-2-inden-1-ylidene-N,N-dimethylethanamine has a molecular weight of 185.27 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-inden-1-ylidene-N,N-dimethylethanamine is sourced from PubChem (CID 6509875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).