About 2-thiophen-3-yl-1,3-dihydroinden-2-amine
2-thiophen-3-yl-1,3-dihydroinden-2-amine (PubChem CID 65099342) has the molecular formula C13H13NS
and a molecular weight of 215.32 g/mol. Its IUPAC name is 2-thiophen-3-yl-1,3-dihydroinden-2-amine.
Molecular Properties
| Compound Name | 2-thiophen-3-yl-1,3-dihydroinden-2-amine |
| PubChem CID | 65099342 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2-thiophen-3-yl-1,3-dihydroinden-2-amine |
| SMILES | NC1(c2ccsc2)Cc2ccccc2C1 |
| InChI | InChI=1S/C13H13NS/c14-13(12-5-6-15-9-12)7-10-3-1-2-4-11(10)8-13/h1-6,9H,7-8,14H2 |
| InChIKey | HPGOIRBHKZDVFE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-thiophen-3-yl-1,3-dihydroinden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-3-yl-1,3-dihydroinden-2-amine?
The IUPAC name of 2-thiophen-3-yl-1,3-dihydroinden-2-amine (CID 65099342) is 2-thiophen-3-yl-1,3-dihydroinden-2-amine.
What is the SMILES notation for 2-thiophen-3-yl-1,3-dihydroinden-2-amine?
The canonical SMILES for 2-thiophen-3-yl-1,3-dihydroinden-2-amine is NC1(c2ccsc2)Cc2ccccc2C1.
What is the InChIKey of 2-thiophen-3-yl-1,3-dihydroinden-2-amine?
The InChIKey is HPGOIRBHKZDVFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NS/c14-13(12-5-6-15-9-12)7-10-3-1-2-4-11(10)8-13/h1-6,9H,7-8,14H2.
What are the key properties of 2-thiophen-3-yl-1,3-dihydroinden-2-amine?
2-thiophen-3-yl-1,3-dihydroinden-2-amine has a molecular weight of 215.32 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-3-yl-1,3-dihydroinden-2-amine is sourced from PubChem (CID 65099342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).