About (3Z)-3-benzylideneindole
(3Z)-3-benzylideneindole (PubChem CID 6509966) has the molecular formula C15H11N
and a molecular weight of 205.26 g/mol. Its IUPAC name is (3Z)-3-benzylideneindole.
Molecular Properties
| Compound Name | (3Z)-3-benzylideneindole |
| PubChem CID | 6509966 |
| Molecular Formula | C15H11N |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | (3Z)-3-benzylideneindole |
| SMILES | C1=Nc2ccccc2/C1=C/c1ccccc1 |
| InChI | InChI=1S/C15H11N/c1-2-6-12(7-3-1)10-13-11-16-15-9-5-4-8-14(13)15/h1-11H/b13-10+ |
| InChIKey | KUMBVBMNTHYPMF-JLHYYAGUSA-N |
| XLogP | 3.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-benzylideneindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-benzylideneindole?
The IUPAC name of (3Z)-3-benzylideneindole (CID 6509966) is (3Z)-3-benzylideneindole.
What is the SMILES notation for (3Z)-3-benzylideneindole?
The canonical SMILES for (3Z)-3-benzylideneindole is C1=Nc2ccccc2/C1=C/c1ccccc1.
What is the InChIKey of (3Z)-3-benzylideneindole?
The InChIKey is KUMBVBMNTHYPMF-JLHYYAGUSA-N. The full InChI is InChI=1S/C15H11N/c1-2-6-12(7-3-1)10-13-11-16-15-9-5-4-8-14(13)15/h1-11H/b13-10+.
What are the key properties of (3Z)-3-benzylideneindole?
(3Z)-3-benzylideneindole has a molecular weight of 205.26 g/mol, XLogP of 3.94, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-benzylideneindole is sourced from PubChem (CID 6509966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).