C13H26N3O4PS3 — CID 6509980
methyl (1Z)-N-[[(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)-propan-2-ylamino]sulfanyl-methylcarbamoyl]oxyethanimidothioate (PubChem CID 6509980) has the molecular formula C13H26N3O4PS3 and a molecular weight of 415.54 g/mol. Its IUPAC name is methyl (1Z)-N-[[(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)-propan-2-ylamino]sulfanyl-methylcarbamoyl]oxyethanimidothioate.
| Compound Name | methyl (1Z)-N-[[(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)-propan-2-ylamino]sulfanyl-methylcarbamoyl]oxyethanimidothioate |
|---|---|
| PubChem CID | 6509980 |
| Molecular Formula | C13H26N3O4PS3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | methyl (1Z)-N-[[(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)-propan-2-ylamino]sulfanyl-methylcarbamoyl]oxyethanimidothioate |
| SMILES | CS/C(C)=N\OC(=O)N(C)SN(C(C)C)P1(=S)OCC(C)(C)CO1 |
| InChI | InChI=1S/C13H26N3O4PS3/c1-10(2)16(21(22)18-8-13(4,5)9-19-21)24-15(6)12(17)20-14-11(3)23-7/h10H,8-9H2,1-7H3/b14-11- |
| InChIKey | CQCSDIDXUWXZQH-KAMYIIQDSA-N |
| XLogP | 4.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|