C12H10Cl2FNS — CID 65100095
1-(2,4-dichloro-5-fluorophenyl)-1-thiophen-3-ylethanamine (PubChem CID 65100095) has the molecular formula C12H10Cl2FNS and a molecular weight of 290.19 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-1-thiophen-3-ylethanamine.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-1-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 65100095 |
| Molecular Formula | C12H10Cl2FNS |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-1-thiophen-3-ylethanamine |
| SMILES | CC(N)(c1ccsc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H10Cl2FNS/c1-12(16,7-2-3-17-6-7)8-4-11(15)10(14)5-9(8)13/h2-6H,16H2,1H3 |
| InChIKey | UEGFPBSOXFVYHV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|