C16H12ClF3O — CID 65100289
5-[chloro-(2,4,6-trifluorophenyl)methyl]-2-methyl-2,3-dihydro-1-benzofuran (PubChem CID 65100289) has the molecular formula C16H12ClF3O and a molecular weight of 312.72 g/mol. Its IUPAC name is 5-[chloro-(2,4,6-trifluorophenyl)methyl]-2-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[chloro-(2,4,6-trifluorophenyl)methyl]-2-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 65100289 |
| Molecular Formula | C16H12ClF3O |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5-[chloro-(2,4,6-trifluorophenyl)methyl]-2-methyl-2,3-dihydro-1-benzofuran |
| SMILES | CC1Cc2cc(C(Cl)c3c(F)cc(F)cc3F)ccc2O1 |
| InChI | InChI=1S/C16H12ClF3O/c1-8-4-10-5-9(2-3-14(10)21-8)16(17)15-12(19)6-11(18)7-13(15)20/h2-3,5-8,16H,4H2,1H3 |
| InChIKey | MKKCTWIYRFVKMT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|