C9H4ClF3N2O — CID 65101529
2-(chloromethyl)-5-(2,4,6-trifluorophenyl)-1,3,4-oxadiazole (PubChem CID 65101529) has the molecular formula C9H4ClF3N2O and a molecular weight of 248.59 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(2,4,6-trifluorophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(2,4,6-trifluorophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 65101529 |
| Molecular Formula | C9H4ClF3N2O |
| Molecular Weight | 248.59 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-(chloromethyl)-5-(2,4,6-trifluorophenyl)-1,3,4-oxadiazole |
| SMILES | Fc1cc(F)c(-c2nnc(CCl)o2)c(F)c1 |
| InChI | InChI=1S/C9H4ClF3N2O/c10-3-7-14-15-9(16-7)8-5(12)1-4(11)2-6(8)13/h1-2H,3H2 |
| InChIKey | LEFRZXFKFJYKFB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.59 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|