C10H6ClF3N2O — CID 65101577
2-(2-chloroethyl)-5-(2,4,6-trifluorophenyl)-1,3,4-oxadiazole (PubChem CID 65101577) has the molecular formula C10H6ClF3N2O and a molecular weight of 262.62 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-(2,4,6-trifluorophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloroethyl)-5-(2,4,6-trifluorophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 65101577 |
| Molecular Formula | C10H6ClF3N2O |
| Molecular Weight | 262.62 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 2-(2-chloroethyl)-5-(2,4,6-trifluorophenyl)-1,3,4-oxadiazole |
| SMILES | Fc1cc(F)c(-c2nnc(CCCl)o2)c(F)c1 |
| InChI | InChI=1S/C10H6ClF3N2O/c11-2-1-8-15-16-10(17-8)9-6(13)3-5(12)4-7(9)14/h3-4H,1-2H2 |
| InChIKey | HOMANECRIQPIAF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|