About 4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene
4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene (PubChem CID 65102071) has the molecular formula C12H19ClS
and a molecular weight of 230.80 g/mol. Its IUPAC name is 4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene.
Molecular Properties
| Compound Name | 4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene |
| PubChem CID | 65102071 |
| Molecular Formula | C12H19ClS |
| Molecular Weight | 230.80 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene |
| SMILES | Cc1cc(CCC(Cl)C(C)(C)C)cs1 |
| InChI | InChI=1S/C12H19ClS/c1-9-7-10(8-14-9)5-6-11(13)12(2,3)4/h7-8,11H,5-6H2,1-4H3 |
| InChIKey | GQSMTQHTJMACFY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.80 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene?
The IUPAC name of 4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene (CID 65102071) is 4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene.
What is the SMILES notation for 4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene?
The canonical SMILES for 4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene is Cc1cc(CCC(Cl)C(C)(C)C)cs1.
What is the InChIKey of 4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene?
The InChIKey is GQSMTQHTJMACFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClS/c1-9-7-10(8-14-9)5-6-11(13)12(2,3)4/h7-8,11H,5-6H2,1-4H3.
What are the key properties of 4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene?
4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene has a molecular weight of 230.80 g/mol, XLogP of 4.64, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloro-4,4-dimethylpentyl)-2-methylthiophene is sourced from PubChem (CID 65102071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).