About 2-ethyl-2,6-dimethylmorpholine
2-ethyl-2,6-dimethylmorpholine (PubChem CID 65102213) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-ethyl-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 2-ethyl-2,6-dimethylmorpholine |
| PubChem CID | 65102213 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-ethyl-2,6-dimethylmorpholine |
| SMILES | CCC1(C)CNCC(C)O1 |
| InChI | InChI=1S/C8H17NO/c1-4-8(3)6-9-5-7(2)10-8/h7,9H,4-6H2,1-3H3 |
| InChIKey | OOCURRISWZUVGI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,6-dimethylmorpholine?
The IUPAC name of 2-ethyl-2,6-dimethylmorpholine (CID 65102213) is 2-ethyl-2,6-dimethylmorpholine.
What is the SMILES notation for 2-ethyl-2,6-dimethylmorpholine?
The canonical SMILES for 2-ethyl-2,6-dimethylmorpholine is CCC1(C)CNCC(C)O1.
What is the InChIKey of 2-ethyl-2,6-dimethylmorpholine?
The InChIKey is OOCURRISWZUVGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-4-8(3)6-9-5-7(2)10-8/h7,9H,4-6H2,1-3H3.
What are the key properties of 2-ethyl-2,6-dimethylmorpholine?
2-ethyl-2,6-dimethylmorpholine has a molecular weight of 143.23 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,6-dimethylmorpholine is sourced from PubChem (CID 65102213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).