About 6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine
6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine (PubChem CID 65102537) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is 6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine.
Molecular Properties
| Compound Name | 6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine |
| PubChem CID | 65102537 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine |
| SMILES | Cc1ccc(C)c(C2CNCC(C)(C)O2)c1 |
| InChI | InChI=1S/C14H21NO/c1-10-5-6-11(2)12(7-10)13-8-15-9-14(3,4)16-13/h5-7,13,15H,8-9H2,1-4H3 |
| InChIKey | QEDTWPOTKHYDAU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine?
The IUPAC name of 6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine (CID 65102537) is 6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine.
What is the SMILES notation for 6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine?
The canonical SMILES for 6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine is Cc1ccc(C)c(C2CNCC(C)(C)O2)c1.
What is the InChIKey of 6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine?
The InChIKey is QEDTWPOTKHYDAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-10-5-6-11(2)12(7-10)13-8-15-9-14(3,4)16-13/h5-7,13,15H,8-9H2,1-4H3.
What are the key properties of 6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine?
6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine has a molecular weight of 219.33 g/mol, XLogP of 2.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dimethylphenyl)-2,2-dimethylmorpholine is sourced from PubChem (CID 65102537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).