C13H19ClN2O2 — CID 65102583
2-[(2-chloro-3-pyridinyl)oxy]-N-(3-methylbutyl)propanamide (PubChem CID 65102583) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 2-[(2-chloro-3-pyridinyl)oxy]-N-(3-methylbutyl)propanamide.
| Compound Name | 2-[(2-chloro-3-pyridinyl)oxy]-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 65102583 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-[(2-chloro-3-pyridinyl)oxy]-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)C(C)Oc1cccnc1Cl |
| InChI | InChI=1S/C13H19ClN2O2/c1-9(2)6-8-16-13(17)10(3)18-11-5-4-7-15-12(11)14/h4-5,7,9-10H,6,8H2,1-3H3,(H,16,17) |
| InChIKey | CNDWFXHLXHGFNG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|