About 1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol
1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol (PubChem CID 65103004) has the molecular formula C12H17N3OS
and a molecular weight of 251.35 g/mol. Its IUPAC name is 1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol.
Molecular Properties
| Compound Name | 1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol |
| PubChem CID | 65103004 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol |
| SMILES | CCC(C)(O)CNc1ccc2scnc2c1N |
| InChI | InChI=1S/C12H17N3OS/c1-3-12(2,16)6-14-8-4-5-9-11(10(8)13)15-7-17-9/h4-5,7,14,16H,3,6,13H2,1-2H3 |
| InChIKey | RMAMZBNKGGVOLH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol?
The IUPAC name of 1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol (CID 65103004) is 1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol.
What is the SMILES notation for 1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol?
The canonical SMILES for 1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol is CCC(C)(O)CNc1ccc2scnc2c1N.
What is the InChIKey of 1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol?
The InChIKey is RMAMZBNKGGVOLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3OS/c1-3-12(2,16)6-14-8-4-5-9-11(10(8)13)15-7-17-9/h4-5,7,14,16H,3,6,13H2,1-2H3.
What are the key properties of 1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol?
1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol has a molecular weight of 251.35 g/mol, XLogP of 2.45, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-amino-1,3-benzothiazol-5-yl)amino]-2-methylbutan-2-ol is sourced from PubChem (CID 65103004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).