C9H16ClNO2 — CID 65105224
2-chloro-N-[(1-hydroxycyclopentyl)methyl]propanamide (PubChem CID 65105224) has the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. Its IUPAC name is 2-chloro-N-[(1-hydroxycyclopentyl)methyl]propanamide.
| Compound Name | 2-chloro-N-[(1-hydroxycyclopentyl)methyl]propanamide |
|---|---|
| PubChem CID | 65105224 |
| Molecular Formula | C9H16ClNO2 |
| Molecular Weight | 205.68 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-chloro-N-[(1-hydroxycyclopentyl)methyl]propanamide |
| SMILES | CC(Cl)C(=O)NCC1(O)CCCC1 |
| InChI | InChI=1S/C9H16ClNO2/c1-7(10)8(12)11-6-9(13)4-2-3-5-9/h7,13H,2-6H2,1H3,(H,11,12) |
| InChIKey | PEDMNBGSMOHMJD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.68 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|