2-(3,4,5-trimethylpyrazol-1-yl)acetic acid

C8H12N2O2 — CID 651055

IUPAC2-(3,4,5-trimethylpyrazol-1-yl)acetic acid
SMILESCc1nn(CC(=O)O)c(C)c1C
InChIInChI=1S/C8H12N2O2/c1-5-6(2)9-10(7(5)3)4-8(11)12/h4H2,1-3H3,(H,11,12)
InChIKeyJLOSUQPSMGZCON-UHFFFAOYSA-N
MW168.20 g/mol
LogP0.89
Rot. Bonds2

About 2-(3,4,5-trimethylpyrazol-1-yl)acetic acid

2-(3,4,5-trimethylpyrazol-1-yl)acetic acid (PubChem CID 651055) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-(3,4,5-trimethylpyrazol-1-yl)acetic acid.

Molecular Properties

Compound Name2-(3,4,5-trimethylpyrazol-1-yl)acetic acid
PubChem CID651055
Molecular FormulaC8H12N2O2
Molecular Weight168.20 g/mol
Exact Mass168.09
IUPAC Name2-(3,4,5-trimethylpyrazol-1-yl)acetic acid
SMILESCc1nn(CC(=O)O)c(C)c1C
InChIInChI=1S/C8H12N2O2/c1-5-6(2)9-10(7(5)3)4-8(11)12/h4H2,1-3H3,(H,11,12)
InChIKeyJLOSUQPSMGZCON-UHFFFAOYSA-N
XLogP0.89
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.20
LogP ≤ 50.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3,4,5-trimethylpyrazol-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4,5-trimethylpyrazol-1-yl)acetic acid?
The IUPAC name of 2-(3,4,5-trimethylpyrazol-1-yl)acetic acid (CID 651055) is 2-(3,4,5-trimethylpyrazol-1-yl)acetic acid.
What is the SMILES notation for 2-(3,4,5-trimethylpyrazol-1-yl)acetic acid?
The canonical SMILES for 2-(3,4,5-trimethylpyrazol-1-yl)acetic acid is Cc1nn(CC(=O)O)c(C)c1C.
What is the InChIKey of 2-(3,4,5-trimethylpyrazol-1-yl)acetic acid?
The InChIKey is JLOSUQPSMGZCON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5-6(2)9-10(7(5)3)4-8(11)12/h4H2,1-3H3,(H,11,12).
What are the key properties of 2-(3,4,5-trimethylpyrazol-1-yl)acetic acid?
2-(3,4,5-trimethylpyrazol-1-yl)acetic acid has a molecular weight of 168.20 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4,5-trimethylpyrazol-1-yl)acetic acid is sourced from PubChem (CID 651055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).