About 3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol
3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol (PubChem CID 65105698) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is 3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol.
Molecular Properties
| Compound Name | 3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol |
| PubChem CID | 65105698 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNC1C2(C)CCC(C2)C1(C)C |
| InChI | InChI=1S/C16H31NO/c1-6-16(18,7-2)11-17-13-14(3,4)12-8-9-15(13,5)10-12/h12-13,17-18H,6-11H2,1-5H3 |
| InChIKey | RVNBKTRBUBTSHP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol?
The IUPAC name of 3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol (CID 65105698) is 3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol.
What is the SMILES notation for 3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol?
The canonical SMILES for 3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol is CCC(O)(CC)CNC1C2(C)CCC(C2)C1(C)C.
What is the InChIKey of 3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol?
The InChIKey is RVNBKTRBUBTSHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO/c1-6-16(18,7-2)11-17-13-14(3,4)12-8-9-15(13,5)10-12/h12-13,17-18H,6-11H2,1-5H3.
What are the key properties of 3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol?
3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol has a molecular weight of 253.43 g/mol, XLogP of 3.34, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]pentan-3-ol is sourced from PubChem (CID 65105698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).