C14H29NO — CID 65105869
3-[[(4,4-dimethylcyclohexyl)amino]methyl]pentan-3-ol (PubChem CID 65105869) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 3-[[(4,4-dimethylcyclohexyl)amino]methyl]pentan-3-ol.
| Compound Name | 3-[[(4,4-dimethylcyclohexyl)amino]methyl]pentan-3-ol |
|---|---|
| PubChem CID | 65105869 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 3-[[(4,4-dimethylcyclohexyl)amino]methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNC1CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H29NO/c1-5-14(16,6-2)11-15-12-7-9-13(3,4)10-8-12/h12,15-16H,5-11H2,1-4H3 |
| InChIKey | UYSISSCDUYADJY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |