C40H24N8Ni — CID 6510602
nickel(2+);5,10,15,20-tetrapyridin-3-ylporphyrin-22,23-diide (PubChem CID 6510602) has the molecular formula C40H24N8Ni and a molecular weight of 675.38 g/mol. Its IUPAC name is nickel(2+);5,10,15,20-tetrapyridin-3-ylporphyrin-22,23-diide.
| Compound Name | nickel(2+);5,10,15,20-tetrapyridin-3-ylporphyrin-22,23-diide |
|---|---|
| PubChem CID | 6510602 |
| Molecular Formula | C40H24N8Ni |
| Molecular Weight | 675.38 g/mol |
| Exact Mass | 674.15 |
| IUPAC Name | nickel(2+);5,10,15,20-tetrapyridin-3-ylporphyrin-22,23-diide |
| SMILES | C1=Cc2nc1c(-c1cccnc1)c1nc(c(-c3cccnc3)c3ccc([n-]3)c(-c3cccnc3)c3ccc([n-]3)c2-c2cccnc2)C=C1.[Ni+2] |
| InChI | InChI=1S/C40H24N8.Ni/c1-5-25(21-41-17-1)37-29-9-11-31(45-29)38(26-6-2-18-42-22-26)33-13-15-35(47-33)40(28-8-4-20-44-24-28)36-16-14-34(48-36)39(27-7-3-19-43-23-27)32-12-10-30(37)46-32;/h1-24H;/q-2;+2/b37-29-,37-30-,38-31-,38-33-,39-32-,39-34-,40-35-,40-36-; |
| InChIKey | BNYOTOXTBZYYJJ-UVCRCORPSA-N |
| XLogP | 8.16 |
| TPSA | 105.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.38 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |