C19H29NO — CID 65107027
1-[[(2-phenylcyclohexyl)amino]methyl]cyclohexan-1-ol (PubChem CID 65107027) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-[[(2-phenylcyclohexyl)amino]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[(2-phenylcyclohexyl)amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65107027 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 1-[[(2-phenylcyclohexyl)amino]methyl]cyclohexan-1-ol |
| SMILES | OC1(CNC2CCCCC2c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C19H29NO/c21-19(13-7-2-8-14-19)15-20-18-12-6-5-11-17(18)16-9-3-1-4-10-16/h1,3-4,9-10,17-18,20-21H,2,5-8,11-15H2 |
| InChIKey | JJTLIXURBHDLCX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |