C15H15Cl2N3O — CID 6510725
(E)-1-(2,4-dichlorophenyl)-5-methyl-2-(1,2,4-triazol-1-yl)hex-1-en-3-one (PubChem CID 6510725) has the molecular formula C15H15Cl2N3O and a molecular weight of 324.21 g/mol. Its IUPAC name is (E)-1-(2,4-dichlorophenyl)-5-methyl-2-(1,2,4-triazol-1-yl)hex-1-en-3-one.
| Compound Name | (E)-1-(2,4-dichlorophenyl)-5-methyl-2-(1,2,4-triazol-1-yl)hex-1-en-3-one |
|---|---|
| PubChem CID | 6510725 |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | (E)-1-(2,4-dichlorophenyl)-5-methyl-2-(1,2,4-triazol-1-yl)hex-1-en-3-one |
| SMILES | CC(C)CC(=O)/C(=C\c1ccc(Cl)cc1Cl)n1cncn1 |
| InChI | InChI=1S/C15H15Cl2N3O/c1-10(2)5-15(21)14(20-9-18-8-19-20)6-11-3-4-12(16)7-13(11)17/h3-4,6-10H,5H2,1-2H3/b14-6+ |
| InChIKey | RHRSEZQUWLVSHO-MKMNVTDBSA-N |
| XLogP | 4.20 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|