About 2-(3-aminophenyl)-1,3-benzothiazol-6-amine
2-(3-aminophenyl)-1,3-benzothiazol-6-amine (PubChem CID 651082) has the molecular formula C13H11N3S
and a molecular weight of 241.32 g/mol. Its IUPAC name is 2-(3-aminophenyl)-1,3-benzothiazol-6-amine.
Molecular Properties
| Compound Name | 2-(3-aminophenyl)-1,3-benzothiazol-6-amine |
| PubChem CID | 651082 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-(3-aminophenyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1cccc(-c2nc3ccc(N)cc3s2)c1 |
| InChI | InChI=1S/C13H11N3S/c14-9-3-1-2-8(6-9)13-16-11-5-4-10(15)7-12(11)17-13/h1-7H,14-15H2 |
| InChIKey | KYIGQQDOCAWDFB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-aminophenyl)-1,3-benzothiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminophenyl)-1,3-benzothiazol-6-amine?
The IUPAC name of 2-(3-aminophenyl)-1,3-benzothiazol-6-amine (CID 651082) is 2-(3-aminophenyl)-1,3-benzothiazol-6-amine.
What is the SMILES notation for 2-(3-aminophenyl)-1,3-benzothiazol-6-amine?
The canonical SMILES for 2-(3-aminophenyl)-1,3-benzothiazol-6-amine is Nc1cccc(-c2nc3ccc(N)cc3s2)c1.
What is the InChIKey of 2-(3-aminophenyl)-1,3-benzothiazol-6-amine?
The InChIKey is KYIGQQDOCAWDFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3S/c14-9-3-1-2-8(6-9)13-16-11-5-4-10(15)7-12(11)17-13/h1-7H,14-15H2.
What are the key properties of 2-(3-aminophenyl)-1,3-benzothiazol-6-amine?
2-(3-aminophenyl)-1,3-benzothiazol-6-amine has a molecular weight of 241.32 g/mol, XLogP of 3.13, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminophenyl)-1,3-benzothiazol-6-amine is sourced from PubChem (CID 651082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).