C15H27NO4 — CID 65108421
1-[2-[(2-hydroxy-2-methylbutyl)amino]-2-oxoethyl]cycloheptane-1-carboxylic acid (PubChem CID 65108421) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is 1-[2-[(2-hydroxy-2-methylbutyl)amino]-2-oxoethyl]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[2-[(2-hydroxy-2-methylbutyl)amino]-2-oxoethyl]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 65108421 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 1-[2-[(2-hydroxy-2-methylbutyl)amino]-2-oxoethyl]cycloheptane-1-carboxylic acid |
| SMILES | CCC(C)(O)CNC(=O)CC1(C(=O)O)CCCCCC1 |
| InChI | InChI=1S/C15H27NO4/c1-3-14(2,20)11-16-12(17)10-15(13(18)19)8-6-4-5-7-9-15/h20H,3-11H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | XOYHNOKDLRZBLP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |