About 4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine
4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine (PubChem CID 651086) has the molecular formula C17H16F2N4O
and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine |
| PubChem CID | 651086 |
| Molecular Formula | C17H16F2N4O |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine |
| SMILES | COc1ccc(-c2cc(C(F)F)nc(-n3nc(C)cc3C)n2)cc1 |
| InChI | InChI=1S/C17H16F2N4O/c1-10-8-11(2)23(22-10)17-20-14(9-15(21-17)16(18)19)12-4-6-13(24-3)7-5-12/h4-9,16H,1-3H3 |
| InChIKey | DUOGQAVYHWVANM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine?
The IUPAC name of 4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine (CID 651086) is 4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine.
What is the SMILES notation for 4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine?
The canonical SMILES for 4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine is COc1ccc(-c2cc(C(F)F)nc(-n3nc(C)cc3C)n2)cc1.
What is the InChIKey of 4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine?
The InChIKey is DUOGQAVYHWVANM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2N4O/c1-10-8-11(2)23(22-10)17-20-14(9-15(21-17)16(18)19)12-4-6-13(24-3)7-5-12/h4-9,16H,1-3H3.
What are the key properties of 4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine?
4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine has a molecular weight of 330.34 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenyl)pyrimidine is sourced from PubChem (CID 651086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).