C10H14ClN3O — CID 65108811
1-[[(3-chloropyrazin-2-yl)amino]methyl]cyclopentan-1-ol (PubChem CID 65108811) has the molecular formula C10H14ClN3O and a molecular weight of 227.69 g/mol. Its IUPAC name is 1-[[(3-chloropyrazin-2-yl)amino]methyl]cyclopentan-1-ol.
| Compound Name | 1-[[(3-chloropyrazin-2-yl)amino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 65108811 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 1-[[(3-chloropyrazin-2-yl)amino]methyl]cyclopentan-1-ol |
| SMILES | OC1(CNc2nccnc2Cl)CCCC1 |
| InChI | InChI=1S/C10H14ClN3O/c11-8-9(13-6-5-12-8)14-7-10(15)3-1-2-4-10/h5-6,15H,1-4,7H2,(H,13,14) |
| InChIKey | SCMJTCIXCZYDKY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |