About 1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol
1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol (PubChem CID 65109046) has the molecular formula C8H15F2NO
and a molecular weight of 179.21 g/mol. Its IUPAC name is 1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol |
| PubChem CID | 65109046 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol |
| SMILES | OC1(CNCC(F)F)CCCC1 |
| InChI | InChI=1S/C8H15F2NO/c9-7(10)5-11-6-8(12)3-1-2-4-8/h7,11-12H,1-6H2 |
| InChIKey | XRCOCMRYNXBUMP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol?
The IUPAC name of 1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol (CID 65109046) is 1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol.
What is the SMILES notation for 1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol?
The canonical SMILES for 1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol is OC1(CNCC(F)F)CCCC1.
What is the InChIKey of 1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol?
The InChIKey is XRCOCMRYNXBUMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NO/c9-7(10)5-11-6-8(12)3-1-2-4-8/h7,11-12H,1-6H2.
What are the key properties of 1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol?
1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol has a molecular weight of 179.21 g/mol, XLogP of 1.15, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,2-difluoroethylamino)methyl]cyclopentan-1-ol is sourced from PubChem (CID 65109046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).