About 1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol
1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol (PubChem CID 65109090) has the molecular formula C12H19ClN4O2
and a molecular weight of 286.76 g/mol. Its IUPAC name is 1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol |
| PubChem CID | 65109090 |
| Molecular Formula | C12H19ClN4O2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol |
| SMILES | CCOc1nc(Cl)nc(NCC2(O)CCCCC2)n1 |
| InChI | InChI=1S/C12H19ClN4O2/c1-2-19-11-16-9(13)15-10(17-11)14-8-12(18)6-4-3-5-7-12/h18H,2-8H2,1H3,(H,14,15,16,17) |
| InChIKey | QBCQCUKDEOHCMH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol?
The IUPAC name of 1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol (CID 65109090) is 1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol.
What is the SMILES notation for 1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol?
The canonical SMILES for 1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol is CCOc1nc(Cl)nc(NCC2(O)CCCCC2)n1.
What is the InChIKey of 1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol?
The InChIKey is QBCQCUKDEOHCMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClN4O2/c1-2-19-11-16-9(13)15-10(17-11)14-8-12(18)6-4-3-5-7-12/h18H,2-8H2,1H3,(H,14,15,16,17).
What are the key properties of 1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol?
1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol has a molecular weight of 286.76 g/mol, XLogP of 2.03, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]cyclohexan-1-ol is sourced from PubChem (CID 65109090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).