C11H15FN2O — CID 65111028
1-[[(5-fluoro-2-pyridinyl)amino]methyl]cyclopentan-1-ol (PubChem CID 65111028) has the molecular formula C11H15FN2O and a molecular weight of 210.25 g/mol. Its IUPAC name is 1-[[(5-fluoro-2-pyridinyl)amino]methyl]cyclopentan-1-ol.
| Compound Name | 1-[[(5-fluoro-2-pyridinyl)amino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 65111028 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-[[(5-fluoro-2-pyridinyl)amino]methyl]cyclopentan-1-ol |
| SMILES | OC1(CNc2ccc(F)cn2)CCCC1 |
| InChI | InChI=1S/C11H15FN2O/c12-9-3-4-10(13-7-9)14-8-11(15)5-1-2-6-11/h3-4,7,15H,1-2,5-6,8H2,(H,13,14) |
| InChIKey | IIIKYWKRMRGRDG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |