About 1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol
1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol (PubChem CID 65111126) has the molecular formula C9H16F3NO2
and a molecular weight of 227.23 g/mol. Its IUPAC name is 1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol |
| PubChem CID | 65111126 |
| Molecular Formula | C9H16F3NO2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol |
| SMILES | OC(CNCC1(O)CCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2/c10-9(11,12)7(14)5-13-6-8(15)3-1-2-4-8/h7,13-15H,1-6H2 |
| InChIKey | CFPIZINJOQMHAV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol?
The IUPAC name of 1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol (CID 65111126) is 1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol.
What is the SMILES notation for 1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol?
The canonical SMILES for 1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol is OC(CNCC1(O)CCCC1)C(F)(F)F.
What is the InChIKey of 1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol?
The InChIKey is CFPIZINJOQMHAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO2/c10-9(11,12)7(14)5-13-6-8(15)3-1-2-4-8/h7,13-15H,1-6H2.
What are the key properties of 1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol?
1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol has a molecular weight of 227.23 g/mol, XLogP of 0.80, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclopentan-1-ol is sourced from PubChem (CID 65111126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).