C16H27NO4 — CID 65111897
3-[[[2-hydroxy-3-(3-methoxyphenoxy)propyl]amino]methyl]pentan-3-ol (PubChem CID 65111897) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-[[[2-hydroxy-3-(3-methoxyphenoxy)propyl]amino]methyl]pentan-3-ol.
| Compound Name | 3-[[[2-hydroxy-3-(3-methoxyphenoxy)propyl]amino]methyl]pentan-3-ol |
|---|---|
| PubChem CID | 65111897 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 3-[[[2-hydroxy-3-(3-methoxyphenoxy)propyl]amino]methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNCC(O)COc1cccc(OC)c1 |
| InChI | InChI=1S/C16H27NO4/c1-4-16(19,5-2)12-17-10-13(18)11-21-15-8-6-7-14(9-15)20-3/h6-9,13,17-19H,4-5,10-12H2,1-3H3 |
| InChIKey | PLCDQBAQZQKGCQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |