About N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide
N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide (PubChem CID 65112212) has the molecular formula C9H16F3NO2
and a molecular weight of 227.23 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide.
Molecular Properties
| Compound Name | N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide |
| PubChem CID | 65112212 |
| Molecular Formula | C9H16F3NO2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide |
| SMILES | CCC(O)(CC)CNC(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2/c1-3-8(15,4-2)6-13-7(14)5-9(10,11)12/h15H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | XSLIFQPYQZJURE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide?
The IUPAC name of N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide (CID 65112212) is N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide.
What is the SMILES notation for N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide?
The canonical SMILES for N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide is CCC(O)(CC)CNC(=O)CC(F)(F)F.
What is the InChIKey of N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide?
The InChIKey is XSLIFQPYQZJURE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO2/c1-3-8(15,4-2)6-13-7(14)5-9(10,11)12/h15H,3-6H2,1-2H3,(H,13,14).
What are the key properties of N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide?
N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide has a molecular weight of 227.23 g/mol, XLogP of 1.61, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethyl-2-hydroxybutyl)-3,3,3-trifluoropropanamide is sourced from PubChem (CID 65112212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).