C17H22ClNOS — CID 65115461
1-[[(3-chloro-1-benzothiophen-2-yl)methylamino]methyl]-4-methylcyclohexan-1-ol (PubChem CID 65115461) has the molecular formula C17H22ClNOS and a molecular weight of 323.89 g/mol. Its IUPAC name is 1-[[(3-chloro-1-benzothiophen-2-yl)methylamino]methyl]-4-methylcyclohexan-1-ol.
| Compound Name | 1-[[(3-chloro-1-benzothiophen-2-yl)methylamino]methyl]-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 65115461 |
| Molecular Formula | C17H22ClNOS |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-[[(3-chloro-1-benzothiophen-2-yl)methylamino]methyl]-4-methylcyclohexan-1-ol |
| SMILES | CC1CCC(O)(CNCc2sc3ccccc3c2Cl)CC1 |
| InChI | InChI=1S/C17H22ClNOS/c1-12-6-8-17(20,9-7-12)11-19-10-15-16(18)13-4-2-3-5-14(13)21-15/h2-5,12,19-20H,6-11H2,1H3 |
| InChIKey | HVOXMSSOSGOLJB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |