C17H27NO3 — CID 65115912
1-[[[2-hydroxy-2-(4-methoxyphenyl)ethyl]amino]methyl]-4-methylcyclohexan-1-ol (PubChem CID 65115912) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-[[[2-hydroxy-2-(4-methoxyphenyl)ethyl]amino]methyl]-4-methylcyclohexan-1-ol.
| Compound Name | 1-[[[2-hydroxy-2-(4-methoxyphenyl)ethyl]amino]methyl]-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 65115912 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-[[[2-hydroxy-2-(4-methoxyphenyl)ethyl]amino]methyl]-4-methylcyclohexan-1-ol |
| SMILES | COc1ccc(C(O)CNCC2(O)CCC(C)CC2)cc1 |
| InChI | InChI=1S/C17H27NO3/c1-13-7-9-17(20,10-8-13)12-18-11-16(19)14-3-5-15(21-2)6-4-14/h3-6,13,16,18-20H,7-12H2,1-2H3 |
| InChIKey | OTXACDPOYQEPNV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |