C20H22ClIN2O — CID 6511644
2-[(Z)-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)amino]oxyethyl-trimethylazanium iodide (PubChem CID 6511644) has the molecular formula C20H22ClIN2O and a molecular weight of 468.77 g/mol. Its IUPAC name is 2-[(Z)-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)amino]oxyethyl-trimethylazanium iodide.
| Compound Name | 2-[(Z)-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)amino]oxyethyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 6511644 |
| Molecular Formula | C20H22ClIN2O |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 2-[(Z)-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)amino]oxyethyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)CCO/N=c1/c2ccccc2ccc2ccc(Cl)cc12.[I-] |
| InChI | InChI=1S/C20H22ClN2O.HI/c1-23(2,3)12-13-24-22-20-18-7-5-4-6-15(18)8-9-16-10-11-17(21)14-19(16)20;/h4-11,14H,12-13H2,1-3H3;1H/q+1;/p-1/b22-20-; |
| InChIKey | WAXOGCOKHKARBC-KGYDJYTLSA-M |
| XLogP | 1.19 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|