C17H32N2O2 — CID 65116578
N-cycloheptyl-2-[(1-hydroxy-4-methylcyclohexyl)methylamino]acetamide (PubChem CID 65116578) has the molecular formula C17H32N2O2 and a molecular weight of 296.46 g/mol. Its IUPAC name is N-cycloheptyl-2-[(1-hydroxy-4-methylcyclohexyl)methylamino]acetamide.
| Compound Name | N-cycloheptyl-2-[(1-hydroxy-4-methylcyclohexyl)methylamino]acetamide |
|---|---|
| PubChem CID | 65116578 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | N-cycloheptyl-2-[(1-hydroxy-4-methylcyclohexyl)methylamino]acetamide |
| SMILES | CC1CCC(O)(CNCC(=O)NC2CCCCCC2)CC1 |
| InChI | InChI=1S/C17H32N2O2/c1-14-8-10-17(21,11-9-14)13-18-12-16(20)19-15-6-4-2-3-5-7-15/h14-15,18,21H,2-13H2,1H3,(H,19,20) |
| InChIKey | ZYXHMAXCRATFHX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |