C16H22Cl2FNO — CID 65116917
1-[[1-(2,6-dichloro-3-fluorophenyl)ethylamino]methyl]-3-methylcyclohexan-1-ol (PubChem CID 65116917) has the molecular formula C16H22Cl2FNO and a molecular weight of 334.26 g/mol. Its IUPAC name is 1-[[1-(2,6-dichloro-3-fluorophenyl)ethylamino]methyl]-3-methylcyclohexan-1-ol.
| Compound Name | 1-[[1-(2,6-dichloro-3-fluorophenyl)ethylamino]methyl]-3-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 65116917 |
| Molecular Formula | C16H22Cl2FNO |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-[[1-(2,6-dichloro-3-fluorophenyl)ethylamino]methyl]-3-methylcyclohexan-1-ol |
| SMILES | CC1CCCC(O)(CNC(C)c2c(Cl)ccc(F)c2Cl)C1 |
| InChI | InChI=1S/C16H22Cl2FNO/c1-10-4-3-7-16(21,8-10)9-20-11(2)14-12(17)5-6-13(19)15(14)18/h5-6,10-11,20-21H,3-4,7-9H2,1-2H3 |
| InChIKey | XJACPONPJYYICC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|