C15H22N4O2 — CID 65116944
1-[[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]methyl]-4-ethylcyclohexan-1-ol (PubChem CID 65116944) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-[[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]methyl]-4-ethylcyclohexan-1-ol.
| Compound Name | 1-[[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]methyl]-4-ethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 65116944 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-[[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]methyl]-4-ethylcyclohexan-1-ol |
| SMILES | CCC1CCC(O)(CNc2ccc(N)c3nonc23)CC1 |
| InChI | InChI=1S/C15H22N4O2/c1-2-10-5-7-15(20,8-6-10)9-17-12-4-3-11(16)13-14(12)19-21-18-13/h3-4,10,17,20H,2,5-9,16H2,1H3 |
| InChIKey | FFONAJQATOZWTP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|