C14H24N4O2 — CID 65117831
4-amino-5-ethyl-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-1H-pyrazole-3-carboxamide (PubChem CID 65117831) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-amino-5-ethyl-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-5-ethyl-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65117831 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 4-amino-5-ethyl-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(=O)NCC2(O)CCC(C)CC2)c1N |
| InChI | InChI=1S/C14H24N4O2/c1-3-10-11(15)12(18-17-10)13(19)16-8-14(20)6-4-9(2)5-7-14/h9,20H,3-8,15H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | XKQRLKXDQRUGSM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |