About 1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol
1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol (PubChem CID 65117893) has the molecular formula C15H25N3O3
and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol |
| PubChem CID | 65117893 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol |
| SMILES | COc1ncnc(OC)c1CNCC1(O)CCC(C)CC1 |
| InChI | InChI=1S/C15H25N3O3/c1-11-4-6-15(19,7-5-11)9-16-8-12-13(20-2)17-10-18-14(12)21-3/h10-11,16,19H,4-9H2,1-3H3 |
| InChIKey | UAGVTEPKZJFLSN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol?
The IUPAC name of 1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol (CID 65117893) is 1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol.
What is the SMILES notation for 1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol?
The canonical SMILES for 1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol is COc1ncnc(OC)c1CNCC1(O)CCC(C)CC1.
What is the InChIKey of 1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol?
The InChIKey is UAGVTEPKZJFLSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O3/c1-11-4-6-15(19,7-5-11)9-16-8-12-13(20-2)17-10-18-14(12)21-3/h10-11,16,19H,4-9H2,1-3H3.
What are the key properties of 1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol?
1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol has a molecular weight of 295.38 g/mol, XLogP of 1.52, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(4,6-dimethoxypyrimidin-5-yl)methylamino]methyl]-4-methylcyclohexan-1-ol is sourced from PubChem (CID 65117893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).